C8H11ClFNO — CID 169155066
N-[(3E)-4-fluoro-2-methoxypenta-1,3-dien-3-yl]ethanimidoyl chloride (PubChem CID 169155066) has the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. Its IUPAC name is N-[(3E)-4-fluoro-2-methoxypenta-1,3-dien-3-yl]ethanimidoyl chloride.
| Compound Name | N-[(3E)-4-fluoro-2-methoxypenta-1,3-dien-3-yl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 169155066 |
| Molecular Formula | C8H11ClFNO |
| Molecular Weight | 191.63 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | N-[(3E)-4-fluoro-2-methoxypenta-1,3-dien-3-yl]ethanimidoyl chloride |
| SMILES | C=C(OC)C(/N=C(\C)Cl)=C(/C)F |
| InChI | InChI=1S/C8H11ClFNO/c1-5(10)8(6(2)12-4)11-7(3)9/h2H2,1,3-4H3/b8-5+,11-7+ |
| InChIKey | YLOOLXIYWOXKRL-FBSVACHXSA-N |
| XLogP | 3.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|