C9H9Cl5O2 — CID 89351492
(3Z,5Z)-3,5,7,7,7-pentachloro-2-methoxy-6-methylhepta-1,3,5-trien-4-ol (PubChem CID 89351492) has the molecular formula C9H9Cl5O2 and a molecular weight of 326.43 g/mol. Its IUPAC name is (3Z,5Z)-3,5,7,7,7-pentachloro-2-methoxy-6-methylhepta-1,3,5-trien-4-ol.
| Compound Name | (3Z,5Z)-3,5,7,7,7-pentachloro-2-methoxy-6-methylhepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 89351492 |
| Molecular Formula | C9H9Cl5O2 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | (3Z,5Z)-3,5,7,7,7-pentachloro-2-methoxy-6-methylhepta-1,3,5-trien-4-ol |
| SMILES | C=C(OC)/C(Cl)=C(O)\C(Cl)=C(/C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H9Cl5O2/c1-4(9(12,13)14)6(10)8(15)7(11)5(2)16-3/h15H,2H2,1,3H3/b6-4-,8-7- |
| InChIKey | DKJVCVWYTVTICI-MOIRPGTBSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|