C13H14ClN3O2 — CID 169156885
(5-chloro-1-methylpyrrolo[3,2-b]pyridin-2-yl)-morpholin-4-ylmethanone (PubChem CID 169156885) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is (5-chloro-1-methylpyrrolo[3,2-b]pyridin-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (5-chloro-1-methylpyrrolo[3,2-b]pyridin-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 169156885 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (5-chloro-1-methylpyrrolo[3,2-b]pyridin-2-yl)-morpholin-4-ylmethanone |
| SMILES | Cn1c(C(=O)N2CCOCC2)cc2nc(Cl)ccc21 |
| InChI | InChI=1S/C13H14ClN3O2/c1-16-10-2-3-12(14)15-9(10)8-11(16)13(18)17-4-6-19-7-5-17/h2-3,8H,4-7H2,1H3 |
| InChIKey | YNVMISCIBODSAE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|