About 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid
1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 169185959) has the molecular formula C25H18ClN3O4S
and a molecular weight of 491.96 g/mol. Its IUPAC name is 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| PubChem CID | 169185959 |
| Molecular Formula | C25H18ClN3O4S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CN(c1ccc(-c2nc(C(=O)O)cc3c2[nH]c2cc(Cl)ccc23)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18ClN3O4S/c1-29(34(32,33)18-5-3-2-4-6-18)17-10-7-15(8-11-17)23-24-20(14-22(28-23)25(30)31)19-12-9-16(26)13-21(19)27-24/h2-14,27H,1H3,(H,30,31) |
| InChIKey | IGOOLECMIYHNQF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The IUPAC name of 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid (CID 169185959) is 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid.
What is the SMILES notation for 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The canonical SMILES for 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid is CN(c1ccc(-c2nc(C(=O)O)cc3c2[nH]c2cc(Cl)ccc23)cc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The InChIKey is IGOOLECMIYHNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18ClN3O4S/c1-29(34(32,33)18-5-3-2-4-6-18)17-10-7-15(8-11-17)23-24-20(14-22(28-23)25(30)31)19-12-9-16(26)13-21(19)27-24/h2-14,27H,1H3,(H,30,31).
What are the key properties of 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid?
1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid has a molecular weight of 491.96 g/mol, XLogP of 5.56, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[benzenesulfonyl(methyl)amino]phenyl]-7-chloro-9H-pyrido[3,4-b]indole-3-carboxylic acid is sourced from PubChem (CID 169185959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).