C24H29N9O4S — CID 169191250
tert-butyl N-[(14R)-7,14-dimethyl-12,16-dioxo-12λ4-thia-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate (PubChem CID 169191250) has the molecular formula C24H29N9O4S and a molecular weight of 539.62 g/mol. Its IUPAC name is tert-butyl N-[(14R)-7,14-dimethyl-12,16-dioxo-12λ4-thia-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(14R)-7,14-dimethyl-12,16-dioxo-12λ4-thia-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 169191250 |
| Molecular Formula | C24H29N9O4S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | tert-butyl N-[(14R)-7,14-dimethyl-12,16-dioxo-12λ4-thia-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate |
| SMILES | C[C@@H]1CS(=O)Cc2cc(c3nnn(C)c3c2)Nc2cc(N(C)C(=O)OC(C)(C)C)c3ncc(n3n2)C(=O)N1 |
| InChI | InChI=1S/C24H29N9O4S/c1-13-11-38(36)12-14-7-15(20-16(8-14)32(6)30-28-20)27-19-9-17(31(5)23(35)37-24(2,3)4)21-25-10-18(22(34)26-13)33(21)29-19/h7-10,13H,11-12H2,1-6H3,(H,26,34)(H,27,29)/t13-,38?/m1/s1 |
| InChIKey | SIKGEKUGJBGDCX-JSTBPVNKSA-N |
| XLogP | 2.51 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|