C24H29N9O5 — CID 176808028
tert-butyl N-[(14R)-14-(hydroxymethyl)-7-methyl-16-oxo-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate (PubChem CID 176808028) has the molecular formula C24H29N9O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is tert-butyl N-[(14R)-14-(hydroxymethyl)-7-methyl-16-oxo-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(14R)-14-(hydroxymethyl)-7-methyl-16-oxo-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 176808028 |
| Molecular Formula | C24H29N9O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | tert-butyl N-[(14R)-14-(hydroxymethyl)-7-methyl-16-oxo-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-21-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1cc2nn3c(cnc13)C(=O)N[C@H](CO)COCc1cc(c3nnn(C)c3c1)N2 |
| InChI | InChI=1S/C24H29N9O5/c1-24(2,3)38-23(36)31(4)17-8-19-27-15-6-13(7-16-20(15)28-30-32(16)5)11-37-12-14(10-34)26-22(35)18-9-25-21(17)33(18)29-19/h6-9,14,34H,10-12H2,1-5H3,(H,26,35)(H,27,29)/t14-/m1/s1 |
| InChIKey | MVLHCDYTTPILCJ-CQSZACIVSA-N |
| XLogP | 1.75 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|