C24H28N8O4 — CID 169191414
tert-butyl N-methyl-N-(14-methyl-16-oxo-12-oxa-2,6,8,15,19,23,24-heptazapentacyclo[15.5.2.13,10.05,9.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl)carbamate (PubChem CID 169191414) has the molecular formula C24H28N8O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(14-methyl-16-oxo-12-oxa-2,6,8,15,19,23,24-heptazapentacyclo[15.5.2.13,10.05,9.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(14-methyl-16-oxo-12-oxa-2,6,8,15,19,23,24-heptazapentacyclo[15.5.2.13,10.05,9.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl)carbamate |
|---|---|
| PubChem CID | 169191414 |
| Molecular Formula | C24H28N8O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | tert-butyl N-methyl-N-(14-methyl-16-oxo-12-oxa-2,6,8,15,19,23,24-heptazapentacyclo[15.5.2.13,10.05,9.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl)carbamate |
| SMILES | CC1COCc2cc(cc3[nH]cnc23)Nc2cc(N(C)C(=O)OC(C)(C)C)c3ncc(n3n2)C(=O)N1 |
| InChI | InChI=1S/C24H28N8O4/c1-13-10-35-11-14-6-15(7-16-20(14)27-12-26-16)29-19-8-17(31(5)23(34)36-24(2,3)4)21-25-9-18(22(33)28-13)32(21)30-19/h6-9,12-13H,10-11H2,1-5H3,(H,26,27)(H,28,33)(H,29,30) |
| InChIKey | PNJVUFYOGADPEN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|