C14H25F5 — CID 169196308
1,2,2,5,5-pentafluoro-3,3,4,4,7,7-hexamethyloctane (PubChem CID 169196308) has the molecular formula C14H25F5 and a molecular weight of 288.34 g/mol. Its IUPAC name is 1,2,2,5,5-pentafluoro-3,3,4,4,7,7-hexamethyloctane.
| Compound Name | 1,2,2,5,5-pentafluoro-3,3,4,4,7,7-hexamethyloctane |
|---|---|
| PubChem CID | 169196308 |
| Molecular Formula | C14H25F5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1,2,2,5,5-pentafluoro-3,3,4,4,7,7-hexamethyloctane |
| SMILES | CC(C)(C)CC(F)(F)C(C)(C)C(C)(C)C(F)(F)CF |
| InChI | InChI=1S/C14H25F5/c1-10(2,3)8-13(16,17)11(4,5)12(6,7)14(18,19)9-15/h8-9H2,1-7H3 |
| InChIKey | LJIGVZXJJRINKY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |