About 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane
1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane (PubChem CID 91413545) has the molecular formula C6H7F7O
and a molecular weight of 228.11 g/mol. Its IUPAC name is 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane.
Analyze 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane?
The IUPAC name of 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane (CID 91413545) is 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane.
What is the SMILES notation for 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane?
The canonical SMILES for 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane is CC(F)(OC(F)(F)CF)C(F)(F)CF.
What is the InChIKey of 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane?
The InChIKey is HYMXCWIDUCFVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F7O/c1-4(9,5(10,11)2-7)14-6(12,13)3-8/h2-3H2,1H3.
What are the key properties of 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane?
1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane has a molecular weight of 228.11 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2,3-tetrafluoro-3-(1,1,2-trifluoroethoxy)butane is sourced from PubChem (CID 91413545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).