C19H15Cl2N5O2 — CID 169197248
2-[6,7-dichloro-2-(5-methoxypyrimidine-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetonitrile (PubChem CID 169197248) has the molecular formula C19H15Cl2N5O2 and a molecular weight of 416.27 g/mol. Its IUPAC name is 2-[6,7-dichloro-2-(5-methoxypyrimidine-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetonitrile.
| Compound Name | 2-[6,7-dichloro-2-(5-methoxypyrimidine-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 169197248 |
| Molecular Formula | C19H15Cl2N5O2 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-[6,7-dichloro-2-(5-methoxypyrimidine-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetonitrile |
| SMILES | COc1cnc(C(=O)N2CCc3c(c4ccc(Cl)c(Cl)c4n3CC#N)C2)nc1 |
| InChI | InChI=1S/C19H15Cl2N5O2/c1-28-11-8-23-18(24-9-11)19(27)25-6-4-15-13(10-25)12-2-3-14(20)16(21)17(12)26(15)7-5-22/h2-3,8-9H,4,6-7,10H2,1H3 |
| InChIKey | ZDYINNMFOUYUOD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|