2-[(9,9-difluorofluoren-3-yl)amino]acetic acid

C15H11F2NO2 — CID 169197961

IUPAC2-[(9,9-difluorofluoren-3-yl)amino]acetic acid
SMILESO=C(O)CNc1ccc2c(c1)-c1ccccc1C2(F)F
InChIInChI=1S/C15H11F2NO2/c16-15(17)12-4-2-1-3-10(12)11-7-9(5-6-13(11)15)18-8-14(19)20/h1-7,18H,8H2,(H,19,20)
InChIKeyQRFMKQKSXDZVSS-UHFFFAOYSA-N
MW275.25 g/mol
LogP3.30
Rot. Bonds3

About 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid

2-[(9,9-difluorofluoren-3-yl)amino]acetic acid (PubChem CID 169197961) has the molecular formula C15H11F2NO2 and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(9,9-difluorofluoren-3-yl)amino]acetic acid
PubChem CID169197961
Molecular FormulaC15H11F2NO2
Molecular Weight275.25 g/mol
Exact Mass275.08
IUPAC Name2-[(9,9-difluorofluoren-3-yl)amino]acetic acid
SMILESO=C(O)CNc1ccc2c(c1)-c1ccccc1C2(F)F
InChIInChI=1S/C15H11F2NO2/c16-15(17)12-4-2-1-3-10(12)11-7-9(5-6-13(11)15)18-8-14(19)20/h1-7,18H,8H2,(H,19,20)
InChIKeyQRFMKQKSXDZVSS-UHFFFAOYSA-N
XLogP3.30
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.25
LogP ≤ 53.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid?
The IUPAC name of 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid (CID 169197961) is 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid.
What is the SMILES notation for 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid?
The canonical SMILES for 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid is O=C(O)CNc1ccc2c(c1)-c1ccccc1C2(F)F.
What is the InChIKey of 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid?
The InChIKey is QRFMKQKSXDZVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2NO2/c16-15(17)12-4-2-1-3-10(12)11-7-9(5-6-13(11)15)18-8-14(19)20/h1-7,18H,8H2,(H,19,20).
What are the key properties of 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid?
2-[(9,9-difluorofluoren-3-yl)amino]acetic acid has a molecular weight of 275.25 g/mol, XLogP of 3.30, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid is sourced from PubChem (CID 169197961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).