C15H11F2NO2 — CID 169197961
2-[(9,9-difluorofluoren-3-yl)amino]acetic acid (PubChem CID 169197961) has the molecular formula C15H11F2NO2 and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid.
| Compound Name | 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 169197961 |
| Molecular Formula | C15H11F2NO2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[(9,9-difluorofluoren-3-yl)amino]acetic acid |
| SMILES | O=C(O)CNc1ccc2c(c1)-c1ccccc1C2(F)F |
| InChI | InChI=1S/C15H11F2NO2/c16-15(17)12-4-2-1-3-10(12)11-7-9(5-6-13(11)15)18-8-14(19)20/h1-7,18H,8H2,(H,19,20) |
| InChIKey | QRFMKQKSXDZVSS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |