C33H31F2N5O4S — CID 169198070
N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide;phenol (PubChem CID 169198070) has the molecular formula C33H31F2N5O4S and a molecular weight of 631.71 g/mol. Its IUPAC name is N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide;phenol.
| Compound Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide;phenol |
|---|---|
| PubChem CID | 169198070 |
| Molecular Formula | C33H31F2N5O4S |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide;phenol |
| SMILES | Oc1ccccc1.[H]/N=C(\N)c1csc(CNC(=O)C2CCCN2C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)c1 |
| InChI | InChI=1S/C27H25F2N5O3S.C6H6O/c28-27(29)20-5-2-1-4-18(20)19-11-15(7-8-21(19)27)25(36)33-13-23(35)34-9-3-6-22(34)26(37)32-12-17-10-16(14-38-17)24(30)31;7-6-4-2-1-3-5-6/h1-2,4-5,7-8,10-11,14,22H,3,6,9,12-13H2,(H3,30,31)(H,32,37)(H,33,36);1-5,7H |
| InChIKey | QKMLTXOLGDHZPE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|