C28H26F2N4O4S — CID 174141946
methyl N-[5-[[[1-[2-(9,9-difluorofluoren-3-yl)acetyl]pyrrolidine-2-carbonyl]amino]methyl]thiophene-3-carboximidoyl]carbamate (PubChem CID 174141946) has the molecular formula C28H26F2N4O4S and a molecular weight of 552.60 g/mol. Its IUPAC name is methyl N-[5-[[[1-[2-(9,9-difluorofluoren-3-yl)acetyl]pyrrolidine-2-carbonyl]amino]methyl]thiophene-3-carboximidoyl]carbamate.
| Compound Name | methyl N-[5-[[[1-[2-(9,9-difluorofluoren-3-yl)acetyl]pyrrolidine-2-carbonyl]amino]methyl]thiophene-3-carboximidoyl]carbamate |
|---|---|
| PubChem CID | 174141946 |
| Molecular Formula | C28H26F2N4O4S |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | methyl N-[5-[[[1-[2-(9,9-difluorofluoren-3-yl)acetyl]pyrrolidine-2-carbonyl]amino]methyl]thiophene-3-carboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC)c1csc(CNC(=O)C2CCCN2C(=O)Cc2ccc3c(c2)-c2ccccc2C3(F)F)c1 |
| InChI | InChI=1S/C28H26F2N4O4S/c1-38-27(37)33-25(31)17-13-18(39-15-17)14-32-26(36)23-7-4-10-34(23)24(35)12-16-8-9-22-20(11-16)19-5-2-3-6-21(19)28(22,29)30/h2-3,5-6,8-9,11,13,15,23H,4,7,10,12,14H2,1H3,(H,32,36)(H2,31,33,37) |
| InChIKey | LMCDZNJMBDBRFI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|