C27H25F2N5O3S — CID 170297801
(2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 170297801) has the molecular formula C27H25F2N5O3S and a molecular weight of 537.59 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170297801 |
| Molecular Formula | C27H25F2N5O3S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2CCCN2C(=O)CNC(=O)c2ccc3c(c2)C(F)(F)c2ccccc2-3)c1 |
| InChI | InChI=1S/C27H25F2N5O3S/c28-27(29)20-5-2-1-4-18(20)19-8-7-15(11-21(19)27)25(36)33-13-23(35)34-9-3-6-22(34)26(37)32-12-17-10-16(14-38-17)24(30)31/h1-2,4-5,7-8,10-11,14,22H,3,6,9,12-13H2,(H3,30,31)(H,32,37)(H,33,36)/t22-/m0/s1 |
| InChIKey | MTZPAVIVCHBBJS-QFIPXVFZSA-N |
| XLogP | 3.19 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|