C19H23FN8O2 — CID 169200618
(E)-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluoropyrimidin-4-yl]-4-imino-3-(5-methoxypyrimidin-2-yl)but-2-enimidamide (PubChem CID 169200618) has the molecular formula C19H23FN8O2 and a molecular weight of 414.45 g/mol. Its IUPAC name is (E)-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluoropyrimidin-4-yl]-4-imino-3-(5-methoxypyrimidin-2-yl)but-2-enimidamide.
| Compound Name | (E)-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluoropyrimidin-4-yl]-4-imino-3-(5-methoxypyrimidin-2-yl)but-2-enimidamide |
|---|---|
| PubChem CID | 169200618 |
| Molecular Formula | C19H23FN8O2 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (E)-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluoropyrimidin-4-yl]-4-imino-3-(5-methoxypyrimidin-2-yl)but-2-enimidamide |
| SMILES | [H]/N=C/C(=C\C(N)=N\c1cc(F)nc(N2C[C@@H](C)O[C@@H](C)C2)n1)c1ncc(OC)cn1 |
| InChI | InChI=1S/C19H23FN8O2/c1-11-9-28(10-12(2)30-11)19-25-15(20)5-17(27-19)26-16(22)4-13(6-21)18-23-7-14(29-3)8-24-18/h4-8,11-12,21H,9-10H2,1-3H3,(H2,22,25,26,27)/b13-4+,21-6+/t11-,12+ |
| InChIKey | SCTYCRLUFSEJDB-AYSPPDOMSA-N |
| XLogP | 1.75 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|