C22H24F3N5O2 — CID 169200883
(Z)-3-[4-(difluoromethoxy)phenyl]-N'-[2-(2,6-dimethylmorpholin-4-yl)-5-fluoro-4-pyridinyl]-4-iminobut-2-enimidamide (PubChem CID 169200883) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-N'-[2-(2,6-dimethylmorpholin-4-yl)-5-fluoro-4-pyridinyl]-4-iminobut-2-enimidamide.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N'-[2-(2,6-dimethylmorpholin-4-yl)-5-fluoro-4-pyridinyl]-4-iminobut-2-enimidamide |
|---|---|
| PubChem CID | 169200883 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N'-[2-(2,6-dimethylmorpholin-4-yl)-5-fluoro-4-pyridinyl]-4-iminobut-2-enimidamide |
| SMILES | [H]/N=C/C(=C\C(N)=N\c1cc(N2CC(C)OC(C)C2)ncc1F)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H24F3N5O2/c1-13-11-30(12-14(2)31-13)21-8-19(18(23)10-28-21)29-20(27)7-16(9-26)15-3-5-17(6-4-15)32-22(24)25/h3-10,13-14,22,26H,11-12H2,1-2H3,(H2,27,28,29)/b16-7+,26-9+ |
| InChIKey | GZLKWPADTKZVHJ-PHYMRNELSA-N |
| XLogP | 4.16 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|