C22H29N7O — CID 169200937
(Z)-3-[4-(dimethylamino)phenyl]-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-4-iminobut-2-enimidamide (PubChem CID 169200937) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is (Z)-3-[4-(dimethylamino)phenyl]-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-4-iminobut-2-enimidamide.
| Compound Name | (Z)-3-[4-(dimethylamino)phenyl]-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-4-iminobut-2-enimidamide |
|---|---|
| PubChem CID | 169200937 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (Z)-3-[4-(dimethylamino)phenyl]-N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-4-yl]-4-iminobut-2-enimidamide |
| SMILES | [H]/N=C/C(=C\C(N)=N\c1ccnc(N2C[C@@H](C)O[C@@H](C)C2)n1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H29N7O/c1-15-13-29(14-16(2)30-15)22-25-10-9-21(27-22)26-20(24)11-18(12-23)17-5-7-19(8-6-17)28(3)4/h5-12,15-16,23H,13-14H2,1-4H3,(H2,24,25,26,27)/b18-11+,23-12+/t15-,16+ |
| InChIKey | YZSDSIUGIFRGCV-CQHQZJCMSA-N |
| XLogP | 2.88 |
| TPSA | 103.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|