C9H6Cl2N2O2 — CID 169206339
methyl 5,6-dichloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate (PubChem CID 169206339) has the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. Its IUPAC name is methyl 5,6-dichloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate.
| Compound Name | methyl 5,6-dichloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 169206339 |
| Molecular Formula | C9H6Cl2N2O2 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | methyl 5,6-dichloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate |
| SMILES | COC(=O)c1c(Cl)c(Cl)nc2[nH]ccc12 |
| InChI | InChI=1S/C9H6Cl2N2O2/c1-15-9(14)5-4-2-3-12-8(4)13-7(11)6(5)10/h2-3H,1H3,(H,12,13) |
| InChIKey | JUQCPZASTDDLKK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|