C26H34N6 — CID 169209644
N,N'-diamino-4-[(3R,4S)-4-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-1-ethylpyrrolidin-3-yl]benzenecarboximidamide (PubChem CID 169209644) has the molecular formula C26H34N6 and a molecular weight of 430.60 g/mol. Its IUPAC name is N,N'-diamino-4-[(3R,4S)-4-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-1-ethylpyrrolidin-3-yl]benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-[(3R,4S)-4-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-1-ethylpyrrolidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 169209644 |
| Molecular Formula | C26H34N6 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | N,N'-diamino-4-[(3R,4S)-4-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-1-ethylpyrrolidin-3-yl]benzenecarboximidamide |
| SMILES | CCN1C[C@@H](Cc2c(C3CC3)cc(C)c3[nH]ccc23)[C@H](c2ccc(/C(=N/N)NN)cc2)C1 |
| InChI | InChI=1S/C26H34N6/c1-3-32-14-20(24(15-32)18-6-8-19(9-7-18)26(30-27)31-28)13-23-21-10-11-29-25(21)16(2)12-22(23)17-4-5-17/h6-12,17,20,24,29H,3-5,13-15,27-28H2,1-2H3,(H,30,31)/t20-,24+/m1/s1 |
| InChIKey | AHAAURXVKDKJSK-YKSBVNFPSA-N |
| XLogP | 3.72 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|