About methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate
methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate (PubChem CID 169212371) has the molecular formula C17H17F2NO3
and a molecular weight of 321.32 g/mol. Its IUPAC name is methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate |
| PubChem CID | 169212371 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate |
| SMILES | COC(=O)CN1CC2(CC2(F)F)c2cc(C3CC3)ccc2C1=O |
| InChI | InChI=1S/C17H17F2NO3/c1-23-14(21)7-20-9-16(8-17(16,18)19)13-6-11(10-2-3-10)4-5-12(13)15(20)22/h4-6,10H,2-3,7-9H2,1H3 |
| InChIKey | DMGKYDOESXEITO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate?
The IUPAC name of methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate (CID 169212371) is methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate.
What is the SMILES notation for methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate?
The canonical SMILES for methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate is COC(=O)CN1CC2(CC2(F)F)c2cc(C3CC3)ccc2C1=O.
What is the InChIKey of methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate?
The InChIKey is DMGKYDOESXEITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO3/c1-23-14(21)7-20-9-16(8-17(16,18)19)13-6-11(10-2-3-10)4-5-12(13)15(20)22/h4-6,10H,2-3,7-9H2,1H3.
What are the key properties of methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate?
methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate has a molecular weight of 321.32 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-cyclopropyl-1',1'-difluoro-1-oxospiro[3H-isoquinoline-4,2'-cyclopropane]-2-yl)acetate is sourced from PubChem (CID 169212371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).