C28H39N5O4 — CID 169215103
4-methoxy-5-[2-(4-methylphenyl)hydrazinyl]-2-[2-(4-nitrophenyl)hydrazinyl]phenol;pent-1-ene;propane (PubChem CID 169215103) has the molecular formula C28H39N5O4 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-methoxy-5-[2-(4-methylphenyl)hydrazinyl]-2-[2-(4-nitrophenyl)hydrazinyl]phenol;pent-1-ene;propane.
| Compound Name | 4-methoxy-5-[2-(4-methylphenyl)hydrazinyl]-2-[2-(4-nitrophenyl)hydrazinyl]phenol;pent-1-ene;propane |
|---|---|
| PubChem CID | 169215103 |
| Molecular Formula | C28H39N5O4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 4-methoxy-5-[2-(4-methylphenyl)hydrazinyl]-2-[2-(4-nitrophenyl)hydrazinyl]phenol;pent-1-ene;propane |
| SMILES | C=CCCC.CCC.COc1cc(NNc2ccc([N+](=O)[O-])cc2)c(O)cc1NNc1ccc(C)cc1 |
| InChI | InChI=1S/C20H21N5O4.C5H10.C3H8/c1-13-3-5-14(6-4-13)22-24-18-11-19(26)17(12-20(18)29-2)23-21-15-7-9-16(10-8-15)25(27)28;1-3-5-4-2;1-3-2/h3-12,21-24,26H,1-2H3;3H,1,4-5H2,2H3;3H2,1-2H3 |
| InChIKey | JIJGXPDAMRYGHB-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|