C44H78N3O12+ — CID 169233820
butane;[2-(hydroxymethyl)-4-[2-[(3-methylimidazol-3-ium-1-carbonyl)-[2-[3-(nonanoyloxymethyl)-4-propanoyloxybutanoyl]oxyethyl]amino]ethoxy]-4-oxobutyl] nonanoate (PubChem CID 169233820) has the molecular formula C44H78N3O12+ and a molecular weight of 841.12 g/mol. Its IUPAC name is butane;[2-(hydroxymethyl)-4-[2-[(3-methylimidazol-3-ium-1-carbonyl)-[2-[3-(nonanoyloxymethyl)-4-propanoyloxybutanoyl]oxyethyl]amino]ethoxy]-4-oxobutyl] nonanoate.
| Compound Name | butane;[2-(hydroxymethyl)-4-[2-[(3-methylimidazol-3-ium-1-carbonyl)-[2-[3-(nonanoyloxymethyl)-4-propanoyloxybutanoyl]oxyethyl]amino]ethoxy]-4-oxobutyl] nonanoate |
|---|---|
| PubChem CID | 169233820 |
| Molecular Formula | C44H78N3O12+ |
| Molecular Weight | 841.12 g/mol |
| Exact Mass | 840.56 |
| IUPAC Name | butane;[2-(hydroxymethyl)-4-[2-[(3-methylimidazol-3-ium-1-carbonyl)-[2-[3-(nonanoyloxymethyl)-4-propanoyloxybutanoyl]oxyethyl]amino]ethoxy]-4-oxobutyl] nonanoate |
| SMILES | CCCC.CCCCCCCCC(=O)OCC(CO)CC(=O)OCCN(CCOC(=O)CC(COC(=O)CC)COC(=O)CCCCCCCC)C(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C40H68N3O12.C4H10/c1-5-8-10-12-14-16-18-36(46)54-29-33(28-44)26-38(48)51-24-22-42(40(50)43-21-20-41(4)32-43)23-25-52-39(49)27-34(30-53-35(45)7-3)31-55-37(47)19-17-15-13-11-9-6-2;1-3-4-2/h20-21,32-34,44H,5-19,22-31H2,1-4H3;3-4H2,1-2H3/q+1; |
| InChIKey | LPNSEKJMPAWQLF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 180.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.12 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|