C13H24IN3O3 — CID 82960510
N,N-bis(2-ethoxyethyl)-3-methylimidazol-3-ium-1-carboxamide iodide (PubChem CID 82960510) has the molecular formula C13H24IN3O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-3-methylimidazol-3-ium-1-carboxamide iodide.
| Compound Name | N,N-bis(2-ethoxyethyl)-3-methylimidazol-3-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 82960510 |
| Molecular Formula | C13H24IN3O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-3-methylimidazol-3-ium-1-carboxamide iodide |
| SMILES | CCOCCN(CCOCC)C(=O)n1cc[n+](C)c1.[I-] |
| InChI | InChI=1S/C13H24N3O3.HI/c1-4-18-10-8-15(9-11-19-5-2)13(17)16-7-6-14(3)12-16;/h6-7,12H,4-5,8-11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UYTNGUITGIVGQL-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|