C11H16N3O5+ — CID 62955558
methyl 2-[(2-methoxy-2-oxoethyl)-(3-methylimidazol-3-ium-1-carbonyl)amino]acetate (PubChem CID 62955558) has the molecular formula C11H16N3O5+ and a molecular weight of 270.26 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-(3-methylimidazol-3-ium-1-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-(3-methylimidazol-3-ium-1-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 62955558 |
| Molecular Formula | C11H16N3O5+ |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-(3-methylimidazol-3-ium-1-carbonyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)C(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C11H16N3O5/c1-12-4-5-13(8-12)11(17)14(6-9(15)18-2)7-10(16)19-3/h4-5,8H,6-7H2,1-3H3/q+1 |
| InChIKey | YUQZHRLVWCBFFN-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|