C16H19Cl3IN3O2 — CID 171379262
3-methyl-N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazol-3-ium-1-carboxamide iodide (PubChem CID 171379262) has the molecular formula C16H19Cl3IN3O2 and a molecular weight of 518.61 g/mol. Its IUPAC name is 3-methyl-N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazol-3-ium-1-carboxamide iodide.
| Compound Name | 3-methyl-N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazol-3-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 171379262 |
| Molecular Formula | C16H19Cl3IN3O2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 516.96 |
| IUPAC Name | 3-methyl-N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazol-3-ium-1-carboxamide iodide |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n1cc[n+](C)c1.[I-] |
| InChI | InChI=1S/C16H19Cl3N3O2.HI/c1-3-4-21(16(23)22-6-5-20(2)11-22)7-8-24-15-13(18)9-12(17)10-14(15)19;/h5-6,9-11H,3-4,7-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | GSCQJNKZRWCFJW-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|