C10H15F3IN3O — CID 55008679
3-methyl-N-propyl-N-(2,2,2-trifluoroethyl)imidazol-3-ium-1-carboxamide iodide (PubChem CID 55008679) has the molecular formula C10H15F3IN3O and a molecular weight of 377.15 g/mol. Its IUPAC name is 3-methyl-N-propyl-N-(2,2,2-trifluoroethyl)imidazol-3-ium-1-carboxamide iodide.
| Compound Name | 3-methyl-N-propyl-N-(2,2,2-trifluoroethyl)imidazol-3-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 55008679 |
| Molecular Formula | C10H15F3IN3O |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 3-methyl-N-propyl-N-(2,2,2-trifluoroethyl)imidazol-3-ium-1-carboxamide iodide |
| SMILES | CCCN(CC(F)(F)F)C(=O)n1cc[n+](C)c1.[I-] |
| InChI | InChI=1S/C10H15F3N3O.HI/c1-3-4-15(7-10(11,12)13)9(17)16-6-5-14(2)8-16;/h5-6,8H,3-4,7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | GZIOLGHRJAUIFC-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|