C10H18N3O2+ — CID 61446685
N-ethyl-N-(2-methoxyethyl)-3-methylimidazol-3-ium-1-carboxamide (PubChem CID 61446685) has the molecular formula C10H18N3O2+ and a molecular weight of 212.27 g/mol. Its IUPAC name is N-ethyl-N-(2-methoxyethyl)-3-methylimidazol-3-ium-1-carboxamide.
| Compound Name | N-ethyl-N-(2-methoxyethyl)-3-methylimidazol-3-ium-1-carboxamide |
|---|---|
| PubChem CID | 61446685 |
| Molecular Formula | C10H18N3O2+ |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | N-ethyl-N-(2-methoxyethyl)-3-methylimidazol-3-ium-1-carboxamide |
| SMILES | CCN(CCOC)C(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C10H18N3O2/c1-4-12(7-8-15-3)10(14)13-6-5-11(2)9-13/h5-6,9H,4,7-8H2,1-3H3/q+1 |
| InChIKey | REAREEDMFGSVPU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|