C40H70N3O11+ — CID 169233826
[4-[2-[2-[3-(decanoyloxymethyl)-4-methoxybutanoyl]oxyethyl-(3-methylimidazol-3-ium-1-carbonyl)amino]ethoxy]-2-(hydroxymethyl)-4-oxobutyl] decanoate (PubChem CID 169233826) has the molecular formula C40H70N3O11+ and a molecular weight of 769.01 g/mol. Its IUPAC name is [4-[2-[2-[3-(decanoyloxymethyl)-4-methoxybutanoyl]oxyethyl-(3-methylimidazol-3-ium-1-carbonyl)amino]ethoxy]-2-(hydroxymethyl)-4-oxobutyl] decanoate.
| Compound Name | [4-[2-[2-[3-(decanoyloxymethyl)-4-methoxybutanoyl]oxyethyl-(3-methylimidazol-3-ium-1-carbonyl)amino]ethoxy]-2-(hydroxymethyl)-4-oxobutyl] decanoate |
|---|---|
| PubChem CID | 169233826 |
| Molecular Formula | C40H70N3O11+ |
| Molecular Weight | 769.01 g/mol |
| Exact Mass | 768.50 |
| IUPAC Name | [4-[2-[2-[3-(decanoyloxymethyl)-4-methoxybutanoyl]oxyethyl-(3-methylimidazol-3-ium-1-carbonyl)amino]ethoxy]-2-(hydroxymethyl)-4-oxobutyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(CO)CC(=O)OCCN(CCOC(=O)CC(COC)COC(=O)CCCCCCCCC)C(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C40H70N3O11/c1-5-7-9-11-13-15-17-19-36(45)53-31-34(29-44)27-38(47)51-25-23-42(40(49)43-22-21-41(3)33-43)24-26-52-39(48)28-35(30-50-4)32-54-37(46)20-18-16-14-12-10-8-6-2/h21-22,33-35,44H,5-20,23-32H2,1-4H3/q+1 |
| InChIKey | QOGQXPDTDPSHGB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 163.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.01 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|