C60H111N3O13 — CID 169291244
[4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-[3-(dimethylamino)propylcarbamoyl]amino]ethoxy]-2-(decanoyloxymethyl)-4-oxobutyl] decanoate (PubChem CID 169291244) has the molecular formula C60H111N3O13 and a molecular weight of 1082.56 g/mol. Its IUPAC name is [4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-[3-(dimethylamino)propylcarbamoyl]amino]ethoxy]-2-(decanoyloxymethyl)-4-oxobutyl] decanoate.
| Compound Name | [4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-[3-(dimethylamino)propylcarbamoyl]amino]ethoxy]-2-(decanoyloxymethyl)-4-oxobutyl] decanoate |
|---|---|
| PubChem CID | 169291244 |
| Molecular Formula | C60H111N3O13 |
| Molecular Weight | 1082.56 g/mol |
| Exact Mass | 1081.81 |
| IUPAC Name | [4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-[3-(dimethylamino)propylcarbamoyl]amino]ethoxy]-2-(decanoyloxymethyl)-4-oxobutyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)CC(=O)OCCN(CCOC(=O)CC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C60H111N3O13/c1-7-11-15-19-23-27-31-36-54(64)73-48-52(49-74-55(65)37-32-28-24-20-16-12-8-2)46-58(68)71-44-42-63(60(70)61-40-35-41-62(5)6)43-45-72-59(69)47-53(50-75-56(66)38-33-29-25-21-17-13-9-3)51-76-57(67)39-34-30-26-22-18-14-10-4/h52-53H,7-51H2,1-6H3,(H,61,70) |
| InChIKey | KUUQDDRXLQTAHJ-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 193.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.56 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|