C57H101N3O13 — CID 169233829
[4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-(imidazole-1-carbonyl)amino]ethoxy]-2-(heptanoyloxymethyl)-4-oxobutyl] decanoate;ethane (PubChem CID 169233829) has the molecular formula C57H101N3O13 and a molecular weight of 1036.44 g/mol. Its IUPAC name is [4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-(imidazole-1-carbonyl)amino]ethoxy]-2-(heptanoyloxymethyl)-4-oxobutyl] decanoate;ethane.
| Compound Name | [4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-(imidazole-1-carbonyl)amino]ethoxy]-2-(heptanoyloxymethyl)-4-oxobutyl] decanoate;ethane |
|---|---|
| PubChem CID | 169233829 |
| Molecular Formula | C57H101N3O13 |
| Molecular Weight | 1036.44 g/mol |
| Exact Mass | 1035.73 |
| IUPAC Name | [4-[2-[2-[4-decanoyloxy-3-(decanoyloxymethyl)butanoyl]oxyethyl-(imidazole-1-carbonyl)amino]ethoxy]-2-(heptanoyloxymethyl)-4-oxobutyl] decanoate;ethane |
| SMILES | CC.CCCCCCCCCC(=O)OCC(COC(=O)CCCCCC)CC(=O)OCCN(CCOC(=O)CC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC)C(=O)n1ccnc1 |
| InChI | InChI=1S/C55H95N3O13.C2H6/c1-5-9-13-17-20-23-27-31-50(60)69-43-47(42-68-49(59)30-26-16-12-8-4)40-53(63)66-38-36-57(55(65)58-35-34-56-46-58)37-39-67-54(64)41-48(44-70-51(61)32-28-24-21-18-14-10-6-2)45-71-52(62)33-29-25-22-19-15-11-7-3;1-2/h34-35,46-48H,5-33,36-45H2,1-4H3;1-2H3 |
| InChIKey | GVDBHEDWITWQNU-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 195.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.44 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|