C62H117NO14 — CID 169233832
2-(decanoyloxymethyl)butyl decanoate;[2-(decanoyloxymethyl)-4-[2-[2-formyloxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-4-oxobutyl] decanoate;ethane (PubChem CID 169233832) has the molecular formula C62H117NO14 and a molecular weight of 1100.61 g/mol. Its IUPAC name is 2-(decanoyloxymethyl)butyl decanoate;[2-(decanoyloxymethyl)-4-[2-[2-formyloxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-4-oxobutyl] decanoate;ethane.
| Compound Name | 2-(decanoyloxymethyl)butyl decanoate;[2-(decanoyloxymethyl)-4-[2-[2-formyloxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-4-oxobutyl] decanoate;ethane |
|---|---|
| PubChem CID | 169233832 |
| Molecular Formula | C62H117NO14 |
| Molecular Weight | 1100.61 g/mol |
| Exact Mass | 1099.85 |
| IUPAC Name | 2-(decanoyloxymethyl)butyl decanoate;[2-(decanoyloxymethyl)-4-[2-[2-formyloxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-4-oxobutyl] decanoate;ethane |
| SMILES | CC.CCCCCCCCCC(=O)OCC(CC)COC(=O)CCCCCCCCC.CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)CC(=O)OCCN(CCOC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H63NO10.C25H48O4.C2H6/c1-6-8-10-12-14-16-18-20-31(38)44-27-30(28-45-32(39)21-19-17-15-13-11-9-7-2)26-33(40)43-25-23-36(22-24-42-29-37)34(41)46-35(3,4)5;1-4-7-9-11-13-15-17-19-24(26)28-21-23(6-3)22-29-25(27)20-18-16-14-12-10-8-5-2;1-2/h29-30H,6-28H2,1-5H3;23H,4-22H2,1-3H3;1-2H3 |
| InChIKey | CLAXHUIPRNOVAK-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 187.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1100.61 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|