C37H37Cl2N4O+ — CID 169234241
2-(2,3-dichloro-4-methylphenyl)-4-(1,1-dimethylaziridin-1-ium-2-yl)-6-[2-[[(E)-1-(3-methylquinolin-6-yl)prop-1-enyl]amino]-1-phenylethyl]pyridin-3-ol (PubChem CID 169234241) has the molecular formula C37H37Cl2N4O+ and a molecular weight of 624.64 g/mol. Its IUPAC name is 2-(2,3-dichloro-4-methylphenyl)-4-(1,1-dimethylaziridin-1-ium-2-yl)-6-[2-[[(E)-1-(3-methylquinolin-6-yl)prop-1-enyl]amino]-1-phenylethyl]pyridin-3-ol.
| Compound Name | 2-(2,3-dichloro-4-methylphenyl)-4-(1,1-dimethylaziridin-1-ium-2-yl)-6-[2-[[(E)-1-(3-methylquinolin-6-yl)prop-1-enyl]amino]-1-phenylethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 169234241 |
| Molecular Formula | C37H37Cl2N4O+ |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 2-(2,3-dichloro-4-methylphenyl)-4-(1,1-dimethylaziridin-1-ium-2-yl)-6-[2-[[(E)-1-(3-methylquinolin-6-yl)prop-1-enyl]amino]-1-phenylethyl]pyridin-3-ol |
| SMILES | C/C=C(/NCC(c1ccccc1)c1cc(C2C[N+]2(C)C)c(O)c(-c2ccc(C)c(Cl)c2Cl)n1)c1ccc2ncc(C)cc2c1 |
| InChI | InChI=1S/C37H36Cl2N4O/c1-6-30(25-13-15-31-26(17-25)16-22(2)19-40-31)41-20-29(24-10-8-7-9-11-24)32-18-28(33-21-43(33,4)5)37(44)36(42-32)27-14-12-23(3)34(38)35(27)39/h6-19,29,33,41H,20-21H2,1-5H3/p+1/b30-6+ |
| InChIKey | QBBLGQHJDHGWMG-KSJARQFSSA-O |
| XLogP | 8.84 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|