C37H40ClN5O2 — CID 168882814
5-[4-amino-3-[(1E,3Z)-1-(methylamino)penta-1,3-dienyl]phenyl]-2-propan-2-ylpyridin-3-ol;5-(8-chloroquinolin-4-yl)-2-propan-2-ylpyridin-3-ol (PubChem CID 168882814) has the molecular formula C37H40ClN5O2 and a molecular weight of 622.21 g/mol. Its IUPAC name is 5-[4-amino-3-[(1E,3Z)-1-(methylamino)penta-1,3-dienyl]phenyl]-2-propan-2-ylpyridin-3-ol;5-(8-chloroquinolin-4-yl)-2-propan-2-ylpyridin-3-ol.
| Compound Name | 5-[4-amino-3-[(1E,3Z)-1-(methylamino)penta-1,3-dienyl]phenyl]-2-propan-2-ylpyridin-3-ol;5-(8-chloroquinolin-4-yl)-2-propan-2-ylpyridin-3-ol |
|---|---|
| PubChem CID | 168882814 |
| Molecular Formula | C37H40ClN5O2 |
| Molecular Weight | 622.21 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | 5-[4-amino-3-[(1E,3Z)-1-(methylamino)penta-1,3-dienyl]phenyl]-2-propan-2-ylpyridin-3-ol;5-(8-chloroquinolin-4-yl)-2-propan-2-ylpyridin-3-ol |
| SMILES | C/C=C\C=C(\NC)c1cc(-c2cnc(C(C)C)c(O)c2)ccc1N.CC(C)c1ncc(-c2ccnc3c(Cl)cccc23)cc1O |
| InChI | InChI=1S/C20H25N3O.C17H15ClN2O/c1-5-6-7-18(22-4)16-10-14(8-9-17(16)21)15-11-19(24)20(13(2)3)23-12-15;1-10(2)16-15(21)8-11(9-20-16)12-6-7-19-17-13(12)4-3-5-14(17)18/h5-13,22,24H,21H2,1-4H3;3-10,21H,1-2H3/b6-5-,18-7+; |
| InChIKey | KAOICTATWZAEHO-RZJDLHHPSA-N |
| XLogP | 9.08 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.21 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|