C32H45NO3Si — CID 169250219
tert-butyl-[2-[5-tert-butyl-2-(5,6-dimethyl-4-phenylmethoxy-2-pyridinyl)phenoxy]ethoxy]-dimethylsilane (PubChem CID 169250219) has the molecular formula C32H45NO3Si and a molecular weight of 519.80 g/mol. Its IUPAC name is tert-butyl-[2-[5-tert-butyl-2-(5,6-dimethyl-4-phenylmethoxy-2-pyridinyl)phenoxy]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[5-tert-butyl-2-(5,6-dimethyl-4-phenylmethoxy-2-pyridinyl)phenoxy]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 169250219 |
| Molecular Formula | C32H45NO3Si |
| Molecular Weight | 519.80 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | tert-butyl-[2-[5-tert-butyl-2-(5,6-dimethyl-4-phenylmethoxy-2-pyridinyl)phenoxy]ethoxy]-dimethylsilane |
| SMILES | Cc1nc(-c2ccc(C(C)(C)C)cc2OCCO[Si](C)(C)C(C)(C)C)cc(OCc2ccccc2)c1C |
| InChI | InChI=1S/C32H45NO3Si/c1-23-24(2)33-28(21-29(23)35-22-25-14-12-11-13-15-25)27-17-16-26(31(3,4)5)20-30(27)34-18-19-36-37(9,10)32(6,7)8/h11-17,20-21H,18-19,22H2,1-10H3 |
| InChIKey | BJBZEMIYMVXYNX-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.80 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|