C27H29FN4O3 — CID 169252741
(11E,15S)-22-(3-fluoro-2-methoxyanilino)-11,12-dimethyl-8-oxa-5,17,21-triazatetracyclo[17.2.1.02,7.015,20]docosa-1(22),2(7),3,5,11,19-hexaen-18-one (PubChem CID 169252741) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is (11E,15S)-22-(3-fluoro-2-methoxyanilino)-11,12-dimethyl-8-oxa-5,17,21-triazatetracyclo[17.2.1.02,7.015,20]docosa-1(22),2(7),3,5,11,19-hexaen-18-one.
| Compound Name | (11E,15S)-22-(3-fluoro-2-methoxyanilino)-11,12-dimethyl-8-oxa-5,17,21-triazatetracyclo[17.2.1.02,7.015,20]docosa-1(22),2(7),3,5,11,19-hexaen-18-one |
|---|---|
| PubChem CID | 169252741 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (11E,15S)-22-(3-fluoro-2-methoxyanilino)-11,12-dimethyl-8-oxa-5,17,21-triazatetracyclo[17.2.1.02,7.015,20]docosa-1(22),2(7),3,5,11,19-hexaen-18-one |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC[C@@H]3CC/C(C)=C(\C)CCOc1cnccc1-2 |
| InChI | InChI=1S/C27H29FN4O3/c1-15-7-8-17-13-30-27(33)22-23(17)32-24(18-9-11-29-14-21(18)35-12-10-16(15)2)25(22)31-20-6-4-5-19(28)26(20)34-3/h4-6,9,11,14,17,31-32H,7-8,10,12-13H2,1-3H3,(H,30,33)/b16-15+/t17-/m0/s1 |
| InChIKey | DLNASVSLVCQXDY-IWLLYFRBSA-N |
| XLogP | 5.69 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|