C25H27FIN4O4- — CID 169252494
CID 169252494 (PubChem CID 169252494) has the molecular formula C25H27FIN4O4- and a molecular weight of 593.42 g/mol.
| Compound Name | CID 169252494 |
|---|---|
| PubChem CID | 169252494 |
| Molecular Formula | C25H27FIN4O4- |
| Molecular Weight | 593.42 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NCC3[I-]OCCC(C)CCOc1cnccc1-2 |
| InChI | InChI=1S/C25H27FIN4O4/c1-14-7-10-34-19-13-28-9-6-15(19)21-23(30-18-5-3-4-16(26)24(18)33-2)20-22(31-21)17(12-29-25(20)32)27-35-11-8-14/h3-6,9,13-14,17,30-31H,7-8,10-12H2,1-2H3,(H,29,32)/q-1 |
| InChIKey | YJYHZOUSHMSHOC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|