C23H23FIN4O4- — CID 169252584
CID 169252584 (PubChem CID 169252584) has the molecular formula C23H23FIN4O4- and a molecular weight of 565.36 g/mol.
| Compound Name | CID 169252584 |
|---|---|
| PubChem CID | 169252584 |
| Molecular Formula | C23H23FIN4O4- |
| Molecular Weight | 565.36 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NCC3[I-]OCCCCOc1cnccc1-2 |
| InChI | InChI=1S/C23H23FIN4O4/c1-31-22-14(24)5-4-6-16(22)28-21-18-20-15(11-27-23(18)30)25-33-10-3-2-9-32-17-12-26-8-7-13(17)19(21)29-20/h4-8,12,15,28-29H,2-3,9-11H2,1H3,(H,27,30)/q-1 |
| InChIKey | SPKOOEWJBXFWDI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|