C23H24FIN5O3- — CID 169252780
CID 169252780 (PubChem CID 169252780) has the molecular formula C23H24FIN5O3- and a molecular weight of 564.38 g/mol.
| Compound Name | CID 169252780 |
|---|---|
| PubChem CID | 169252780 |
| Molecular Formula | C23H24FIN5O3- |
| Molecular Weight | 564.38 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC[C@H]3[I-]N(C)CCCOc1cnccc1-2 |
| InChI | InChI=1S/C23H24FIN5O3/c1-30-9-4-10-33-17-12-26-8-7-13(17)19-21(28-16-6-3-5-14(24)22(16)32-2)18-20(29-19)15(25-30)11-27-23(18)31/h3,5-8,12,15,28-29H,4,9-11H2,1-2H3,(H,27,31)/q-1/t15-/m1/s1 |
| InChIKey | RMIHHUKOSAHUKC-OAHLLOKOSA-N |
| XLogP | 0.47 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|