C23H23FIN4O3- — CID 169253061
CID 169253061 (PubChem CID 169253061) has the molecular formula C23H23FIN4O3- and a molecular weight of 549.36 g/mol.
| Compound Name | CID 169253061 |
|---|---|
| PubChem CID | 169253061 |
| Molecular Formula | C23H23FIN4O3- |
| Molecular Weight | 549.36 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NCC3[I-]CC(C)COc1cnccc1-2 |
| InChI | InChI=1S/C23H23FIN4O3/c1-12-8-25-15-9-27-23(30)18-20(15)29-19(13-6-7-26-10-17(13)32-11-12)21(18)28-16-5-3-4-14(24)22(16)31-2/h3-7,10,12,15,28-29H,8-9,11H2,1-2H3,(H,27,30)/q-1 |
| InChIKey | MVVPLTXJOJOKBL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|