C27H29FIN4O4- — CID 169253162
CID 169253162 (PubChem CID 169253162) has the molecular formula C27H29FIN4O4- and a molecular weight of 619.46 g/mol.
| Compound Name | CID 169253162 |
|---|---|
| PubChem CID | 169253162 |
| Molecular Formula | C27H29FIN4O4- |
| Molecular Weight | 619.46 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NCC3[I-]OCC/C(C)=C(/C)CCOc1cnccc1-2 |
| InChI | InChI=1S/C27H29FIN4O4/c1-15-8-11-36-21-14-30-10-7-17(21)23-25(32-20-6-4-5-18(28)26(20)35-3)22-24(33-23)19(13-31-27(22)34)29-37-12-9-16(15)2/h4-7,10,14,19,32-33H,8-9,11-13H2,1-3H3,(H,31,34)/q-1/b16-15- |
| InChIKey | WKJNFDZQAWTGDR-NXVVXOECSA-N |
| XLogP | 2.28 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|