C20H18FI2N7O3-2 — CID 169252767
CID 169252767 (PubChem CID 169252767) has the molecular formula C20H18FI2N7O3-2 and a molecular weight of 677.22 g/mol.
| Compound Name | CID 169252767 |
|---|---|
| PubChem CID | 169252767 |
| Molecular Formula | C20H18FI2N7O3-2 |
| Molecular Weight | 677.22 g/mol |
| Exact Mass | 676.96 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC(C3)[I-]NC(=O)N[I-]Nc1cnccc1-2 |
| InChI | InChI=1S/C20H18FI2N7O3/c1-33-18-10(21)3-2-4-11(18)25-17-15-12-7-14(27-19(15)31)22-29-20(32)30-23-28-13-8-24-6-5-9(13)16(17)26-12/h2-6,8,14,25-26,28H,7H2,1H3,(H,27,31)(H2,29,30,32)/q-2 |
| InChIKey | IPRRNARBQUIMIF-UHFFFAOYSA-N |
| XLogP | -3.77 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.22 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|