C23H23FIN6O3- — CID 169252927
CID 169252927 (PubChem CID 169252927) has the molecular formula C23H23FIN6O3- and a molecular weight of 577.38 g/mol.
| Compound Name | CID 169252927 |
|---|---|
| PubChem CID | 169252927 |
| Molecular Formula | C23H23FIN6O3- |
| Molecular Weight | 577.38 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC(C3)[I-]C(=O)NCCCNc1cnccc1-2 |
| InChI | InChI=1S/C23H23FIN6O3/c1-34-21-13(24)4-2-5-14(21)29-20-18-15-10-17(31-22(18)32)25-23(33)28-8-3-7-27-16-11-26-9-6-12(16)19(20)30-15/h2,4-6,9,11,17,27,29-30H,3,7-8,10H2,1H3,(H,28,33)(H,31,32)/q-1 |
| InChIKey | JOAIPDVPPQXSCT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|