C25H28FIN5O2- — CID 169252775
CID 169252775 (PubChem CID 169252775) has the molecular formula C25H28FIN5O2- and a molecular weight of 576.43 g/mol.
| Compound Name | CID 169252775 |
|---|---|
| PubChem CID | 169252775 |
| Molecular Formula | C25H28FIN5O2- |
| Molecular Weight | 576.43 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC(C3)[I-]CCC(C)CCNc1cnccc1-2 |
| InChI | InChI=1S/C25H28FIN5O2/c1-14-6-9-27-20-12-18-21(25(33)32-20)23(30-17-5-3-4-16(26)24(17)34-2)22(31-18)15-8-10-28-13-19(15)29-11-7-14/h3-5,8,10,13-14,20,29-31H,6-7,9,11-12H2,1-2H3,(H,32,33)/q-1 |
| InChIKey | MEBFDASKBJGZCA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|