C19H15FI2N4O4-2 — CID 169253148
CID 169253148 (PubChem CID 169253148) has the molecular formula C19H15FI2N4O4-2 and a molecular weight of 636.16 g/mol.
| Compound Name | CID 169253148 |
|---|---|
| PubChem CID | 169253148 |
| Molecular Formula | C19H15FI2N4O4-2 |
| Molecular Weight | 636.16 g/mol |
| Exact Mass | 635.92 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)N[C@H](C3)[I-]O[I-]Oc1cnccc1-2 |
| InChI | InChI=1S/C19H15FI2N4O4/c1-28-18-10(20)3-2-4-11(18)24-17-15-12-7-14(26-19(15)27)21-30-22-29-13-8-23-6-5-9(13)16(17)25-12/h2-6,8,14,24-25H,7H2,1H3,(H,26,27)/q-2/t14-/m1/s1 |
| InChIKey | JKAPCSNYIYLEBC-CQSZACIVSA-N |
| XLogP | -3.09 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.16 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|