C20H16FI2N5O4-2 — CID 169252875
CID 169252875 (PubChem CID 169252875) has the molecular formula C20H16FI2N5O4-2 and a molecular weight of 663.19 g/mol.
| Compound Name | CID 169252875 |
|---|---|
| PubChem CID | 169252875 |
| Molecular Formula | C20H16FI2N5O4-2 |
| Molecular Weight | 663.19 g/mol |
| Exact Mass | 662.93 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)N[C@H](C3)[I-]OC(=O)[I-]Nc1cnccc1-2 |
| InChI | InChI=1S/C20H16FI2N5O4/c1-31-18-10(21)3-2-4-11(18)25-17-15-12-7-14(27-19(15)29)23-32-20(30)22-28-13-8-24-6-5-9(13)16(17)26-12/h2-6,8,14,25-26,28H,7H2,1H3,(H,27,29)/q-2/t14-/m1/s1 |
| InChIKey | JMSOXHNMAFVLLQ-CQSZACIVSA-N |
| XLogP | -2.85 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.19 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|