About CID 169253074
CID 169253074 (PubChem CID 169253074) has the molecular formula C26H27FIN6O4-
and a molecular weight of 633.44 g/mol.
Molecular Properties
| Compound Name | CID 169253074 |
| PubChem CID | 169253074 |
| Molecular Formula | C26H27FIN6O4- |
| Molecular Weight | 633.44 g/mol |
| Exact Mass | 633.11 |
| IUPAC Name | — |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC[C@H]3[I-]OC(=O)N1CCC(CC1)CNc1cnccc1-2 |
| InChI | InChI=1S/C26H27FIN6O4/c1-37-24-16(27)3-2-4-18(24)32-23-20-22-17(12-31-25(20)35)28-38-26(36)34-9-6-14(7-10-34)11-30-19-13-29-8-5-15(19)21(23)33-22/h2-5,8,13-14,17,30,32-33H,6-7,9-12H2,1H3,(H,31,35)/q-1/t17-/m1/s1 |
| InChIKey | VMTIONBUIGCRKG-QGZVFWFLSA-N |
| XLogP | 1.03 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 633.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 169253074 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169253074?
The IUPAC name of CID 169253074 (CID 169253074) is not available.
What is the SMILES notation for CID 169253074?
The canonical SMILES for CID 169253074 is COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC[C@H]3[I-]OC(=O)N1CCC(CC1)CNc1cnccc1-2.
What is the InChIKey of CID 169253074?
The InChIKey is VMTIONBUIGCRKG-QGZVFWFLSA-N. The full InChI is InChI=1S/C26H27FIN6O4/c1-37-24-16(27)3-2-4-18(24)32-23-20-22-17(12-31-25(20)35)28-38-26(36)34-9-6-14(7-10-34)11-30-19-13-29-8-5-15(19)21(23)33-22/h2-5,8,13-14,17,30,32-33H,6-7,9-12H2,1H3,(H,31,35)/q-1/t17-/m1/s1.
What are the key properties of CID 169253074?
CID 169253074 has a molecular weight of 633.44 g/mol, XLogP of 1.03, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169253074 is sourced from PubChem (CID 169253074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).