C18H20BrClFN5S — CID 169255976
5-bromo-7-chloro-4-[(1S,2S,5R)-2-ethenyl-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 169255976) has the molecular formula C18H20BrClFN5S and a molecular weight of 472.82 g/mol. Its IUPAC name is 5-bromo-7-chloro-4-[(1S,2S,5R)-2-ethenyl-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 5-bromo-7-chloro-4-[(1S,2S,5R)-2-ethenyl-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 169255976 |
| Molecular Formula | C18H20BrClFN5S |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 5-bromo-7-chloro-4-[(1S,2S,5R)-2-ethenyl-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | C=C[C@H]1[C@@H]2CC[C@H](CN1c1nc(SCC)nc3c(F)c(Cl)nc(Br)c13)N2C |
| InChI | InChI=1S/C18H20BrClFN5S/c1-4-10-11-7-6-9(25(11)3)8-26(10)17-12-14(22-18(24-17)27-5-2)13(21)16(20)23-15(12)19/h4,9-11H,1,5-8H2,2-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | GGNJYZIDHJFNHM-VWYCJHECSA-N |
| XLogP | 4.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|