C19H24BrClFN5S — CID 169254947
5-bromo-4-(2-but-1-en-2-yl-2-ethylpiperazin-1-yl)-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 169254947) has the molecular formula C19H24BrClFN5S and a molecular weight of 488.86 g/mol. Its IUPAC name is 5-bromo-4-(2-but-1-en-2-yl-2-ethylpiperazin-1-yl)-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 5-bromo-4-(2-but-1-en-2-yl-2-ethylpiperazin-1-yl)-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 169254947 |
| Molecular Formula | C19H24BrClFN5S |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 5-bromo-4-(2-but-1-en-2-yl-2-ethylpiperazin-1-yl)-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | C=C(CC)C1(CC)CNCCN1c1nc(SCC)nc2c(F)c(Cl)nc(Br)c12 |
| InChI | InChI=1S/C19H24BrClFN5S/c1-5-11(4)19(6-2)10-23-8-9-27(19)17-12-14(24-18(26-17)28-7-3)13(22)16(21)25-15(12)20/h23H,4-10H2,1-3H3 |
| InChIKey | ZYVILVJEDVQGKL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|