C17H21ClFN5S — CID 169255828
(4R,7R)-12-chloro-4-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene (PubChem CID 169255828) has the molecular formula C17H21ClFN5S and a molecular weight of 381.91 g/mol. Its IUPAC name is (4R,7R)-12-chloro-4-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene.
| Compound Name | (4R,7R)-12-chloro-4-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
|---|---|
| PubChem CID | 169255828 |
| Molecular Formula | C17H21ClFN5S |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (4R,7R)-12-chloro-4-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)CC[C@@H]1CN[C@H](CC)CN21 |
| InChI | InChI=1S/C17H21ClFN5S/c1-3-9-8-24-10(7-20-9)5-6-11-12-14(13(19)15(18)21-11)22-17(25-4-2)23-16(12)24/h9-10,20H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | WBOWXFLKEMIUTL-NXEZZACHSA-N |
| XLogP | 3.43 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|