C17H21ClF3N5S — CID 169255138
12-chloro-16-ethylsulfanyl-9,9,13-trifluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane (PubChem CID 169255138) has the molecular formula C17H21ClF3N5S and a molecular weight of 419.90 g/mol. Its IUPAC name is 12-chloro-16-ethylsulfanyl-9,9,13-trifluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane.
| Compound Name | 12-chloro-16-ethylsulfanyl-9,9,13-trifluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane |
|---|---|
| PubChem CID | 169255138 |
| Molecular Formula | C17H21ClF3N5S |
| Molecular Weight | 419.90 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 12-chloro-16-ethylsulfanyl-9,9,13-trifluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene;ethane |
| SMILES | CC.CCSc1nc2c3c(nc(Cl)c(F)c3n1)C(F)(F)CC1CNCCN21 |
| InChI | InChI=1S/C15H15ClF3N5S.C2H6/c1-2-25-14-21-10-8-11(22-12(16)9(10)17)15(18,19)5-7-6-20-3-4-24(7)13(8)23-14;1-2/h7,20H,2-6H2,1H3;1-2H3 |
| InChIKey | HBWJGEIEJYNNLN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.90 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|